| Nom | Sarmientite |
| └─ Allemand (de) | Sarmientit |
| └─ Anglais (en) | Sarmientite |
| └─ Espagnol (es) | Sarmientita |
| └─ Français (fr) | Sarmientite |
| └─ Russe (ru) | Сармиентит |
| Origine | Named for Domingo Faustino Sarmiento (1811-1888), former President of Argentina. |
| Statut | G ▶ Hérité |
| Nom | Sarmientite |
| Code | 1941 |
| Symbole | Smi |
| Formule | Fe3+2(AsO4)(SO4)(OH)(H2O)5 |
| Pays | ARG |
| Météorite | Non |
| Référence 1 | Notulae Naturae of the Academy of Natural Sciences of Philadelphia (1941), 92 |
| Référence 2 | Mineralogical Magazine 78 (2014), 347 |
| Archive | 2025-11 |
| Webmineral | Fe+++2(AsO4)(SO4)(OH) |
| Mineralienatlas | Fe23+(AsO4)(SO4)(OH) • 5H2O |
| Mineralienatlas (Empirique) | Fe2(AsO4)(SO4)(OH) • 5H2O |
| Rruff | Fe3+2(As5+O4)(S6+O4)(OH) • 5H2O |
| Formule de référence | Fe2(AsO4)(SO4)(OH) • 5H2O |
| Masse atomique (u ≡ Da) | 453.7588 |
| Masse molaire #1 (g.mol-1) | 453.7588 |
| Element | Quantité | % Atomes | Masse (u ≡ Da) | Total masse (u ≡ Da) | % Masse |
|---|---|---|---|---|---|
| H | 11.00 | 37.93 | 1.00797500 | 11.08772500 | 2.44 |
| O | 14.00 | 48.28 | 15.99940000 | 223.99160000 | 49.36 |
| S | 1.00 | 3.45 | 32.06750000 | 32.06750000 | 7.07 |
| Fe | 2.00 | 6.90 | 55.84520000 | 111.69040000 | 24.61 |
| As | 1.00 | 3.45 | 74.92159500 | 74.92159500 | 16.51 |
| Total | 29.00 | 100.00 | 453.75882000 | 100.00 |
| Dureté de Mohs | |
| Dureté de Vickers | |
| Densité électronique #1 (g/cm3) | 2.55 |
| Indice de fermions | 0,006 |
| Indice de bosons | 0,994 |
| Photoélectricité | |
| └─ PESarmientite (barns/électron) | 18,6 |
| └─ U #2 (barns/cm3) | 47,43 |
| GRapi #3 | 0 |
| Strunz 9ed. | 08 ▶ Phosphates, arséniates, vanadates └─ 08.D ▶ Phosphates, etc └─ 08.DB ▶ Avec only medium-sized cations, (OH, etc) : RO4 < 1:1 └─ 08.DB.35 ▶ Sarmientite |
| Dana 8ed. | 43 ▶ Compound Phosphates, etc └─ 43.05 ▶ Compound Phosphates, etc (Hydratés Anions composés avec Hydroxyle ou Halogène) └─ 43.05.01 ▶ Sarmientite group └─ 43.05.01.01 ▶ Sarmientite |
| CIM Hey's | |
| Lapis | VII ▶ Phosphates et arsénates (« phosphates » incluent toujours les arsénates et les vanadates isotypes) └─ VII/D ▶ Phosphates hydratés, avec anions étrangers └─ VII/D.05 ▶ Cations moyens : Cu–Zn–Mn–Al–Fe └─ VII/D.05-030 ▶ Sarmientite |
| Hölzel | 8 ▶ Phosphates, arsénates, vanadates └─ 8.D ▶ Phosphates avec autres anions, avec H2O └─ 8.DC.5 ▶ Avec autres anions complexes, OH/XO4 = 1/2 Groupe de la Diadochite └─ 8.DC.540 ▶ Sarmientite |
| Système cristallin | |
| └─ Notation Hermann–Mauguin | |
| └─ Règles longueurs | |
| └─ Règles angles | |
| Classe cristalline | |
| └─ Notation Hermann–Mauguin | |
| └─ Notation Schoenflies | |
| └─ Axes binaires (180°) | 0 |
| └─ Axes ternaires (120°) | 0 |
| └─ Axes quaternaires (90°) | 0 |
| └─ Axes senaires (60°) | 0 |
| └─ Plans de symétrie | 0 |
| └─ Inversion centrale | Oui |
| Groupe d'espace | |
| └─ Notation Hermann–Mauguin | |
| Groupe de plan | |
| └─ Notation Hermann–Mauguin | |
| Mailles | |
| └─ a (Å) | 6.55 |
| └─ b (Å) | 18.55 |
| └─ c (Å) | 9.70 |
| Rapport | |
| └─ Rapport a/b | 0.353 |
| └─ Rapport c/a | 1.481 |
| └─ Rapport c/b | 0.523 |
| Angles | |
| └─ α (°) | 90 |
| └─ β (°) | 97.65 |
| └─ γ (°) | 90 |
| Z #1 | 4 |
| Volume (calculé) #2 (Å3) | 1168.085 |
| Densité (calculé) ρ #3 (g/cm3) | 2.580 |
| Système cristallin | |
| └─ Angle 2V | (+) |
| └─ Angle (°) | 38° |
| └─ Anisotropie | Non |
| └─ Biréfringence Maxi. | 0.070 |
| └─ Absorption | Aucune |
| └─ Pléochroïsme | Aucun |
| └─ Pléochroïsme X | Aucun |
| └─ Pléochroïsme Y | Aucun |
| └─ Pléochroïsme Z | Aucun |
| └─ Indice moyen | 1,654 |
| └─ Indice α / ω / n | 1,628 |
| └─ Indice β | 1,635 |
| └─ Indice γ / ε | 1,698 |
| Validation Gladstone-Dale | |
| └─ KC #1 | 0.2574 |
| └─ KPD calculé | 0.2534 |
| └─ CI #2 calculé | 0,016 ▶ Excellent |
| └─ KPD mesuré | 0.2534 |
| └─ CI #2 mesuré | 0,016 ▶ Excellent |
| └─ N calculé | |
| Opacité |
| UV longs (365 nm) | |
| └─ Fréquence | |
| └─ Intesité | |
| └─ Couleurs | |
| └─ Autres couleurs | |
| UV moyens (320 nm) | |
| └─ Fréquence | |
| └─ Intesité | |
| └─ Couleurs | |
| └─ Autres couleurs | |
| UV courts (254 nm) | |
| └─ Fréquence | |
| └─ Intesité | |
| └─ Couleurs | |
| └─ Autres couleurs | |
| Fluorescence UV | |
| └─ Activateur principal | |
| └─ Autres activateurs |
| Handbook of mineralogy | https://handbookofmineralogy.org/pdfs/sarmientite.pdf |
| Mindat | http://www.mindat.org/show.php?name=sarmientite |
| Mineralienatlas | https://www.mineralienatlas.de/lexikon/index.php/MineralData?mineral=sarmientite |
| RRUFF | https://rruff.net/sarmientite |
| Rruff IMA | https://www.rruff.net/ima-mineral-list/?sarmientite |
| Smorf Crystal Model | https://www.smorf.nl/crystals_az_naam.php?naam=s |
| Strahlen | https://www.strahlen.org/tw/fotoatlas1/sarmientite_foto.html |
| Webmineral | https://webmineral.com/data/Sarmientite.shtml |
| 1001 Minéraux | https://1001mineraux.com/collections/sarmientite |
| Anton Waltz Minerals | https://www.awminerals.com/ |
| e-rocks | https://e-rocks.com/itemssearch?search=sarmientite&op=Submit&form_id=klondike_search_quick_form |
| FossilEra | https://www.fossilera.com/minerals-for-sale/sarmientite |
| Gem Select | https://www.gemselect.com/sarmientite/sarmientite.php |
| Gemfrance | https://www.gemfrance.com/catalogsearch/result/?q=sarmientite |
| Le Comptoir Géologique (Gemmes) | https://www.le-comptoir-geologique.com/sarmientite-gemme.html |
| Le Comptoir Géologique (Minéraux) | https://www.le-comptoir-geologique.com/sarmientite-mineraux.html |
| Pegmatite | http://pegmatite.ru |
| Shungite.fr (La Roche Mère) | https://shungite.fr/fr/recherche?controller=search&s=sarmientite |
| The Arkenstone | https://www.irocks.com/search?mode=advanced&query=sarmientite&status%5B%5D=available&status%5B%5D=on-hold&status%5B%5D=sold |
| Weinrich Minerals | https://www.weinrichmineralsinc.com/product/shop/archive?name=sarmientite |