| Nom | Fornacite |
| └─ Allemand (de) | Fornacit |
| └─ Allemand (de) | Furnacit |
| └─ Anglais (en) | Fornacite |
| └─ Espagnol (es) | Fornacita |
| └─ Espagnol (es) | Furnacita |
| └─ Français (fr) | Fornacite |
| └─ Néerlandais (nl) | Fornaciet |
| └─ Russe (ru) | Форнасит |
| Origine | Named for Lucien Lewis Forneau (1867-1930), Colonial Governor of the French Congo. |
| Statut | G ▶ Hérité |
| Nom | Fornacite |
| Code | 1915 |
| Symbole | For |
| Formule | CuPb2(CrO4)(AsO4)(OH) |
| Pays | COG |
| Météorite | Non |
| Référence 1 | Bulletin de la Société Française de Minéralogie 38 (1915), 198 |
| Référence 2 | Doklady Earth Sciences 456 (2014), 520 |
| Archive | 2025-11 |
| Webmineral | Pb2Cu(CrO4)(AsO4)(OH) |
| Mineralienatlas | (Pb,Cu)3[(Cr,As)O4]2(OH) |
| Mineralienatlas (Empirique) | (Pb0.75Cu0.25)3[(Cr0.75As0.25)O4]2(OH) |
| Rruff | Cu2+Pb2+2(Cr6+O4)(As5+O4)(OH) |
| Formule de référence | (Pb0.75Cu0.25)3[(Cr0.75As0.25)O4]2(OH) |
| Masse atomique (u ≡ Da) | 774.3398 |
| Masse molaire #1 (g.mol-1) | 774.3398 |
| Element | Quantité | % Atomes | Masse (u ≡ Da) | Total masse (u ≡ Da) | % Masse |
|---|---|---|---|---|---|
| H | 1.00 | 6.67 | 1.00797500 | 1.00797500 | 0.13 |
| O | 9.00 | 60.00 | 15.99940000 | 143.99460000 | 18.60 |
| Cr | 1.50 | 10.00 | 51.99616000 | 77.99424000 | 10.07 |
| Cu | 0.75 | 5.00 | 63.54630000 | 47.65972500 | 6.15 |
| As | 0.50 | 3.33 | 74.92159500 | 37.46079750 | 4.84 |
| Pb | 2.25 | 15.00 | 207.21000000 | 466.22250000 | 60.21 |
| Total | 15.00 | 100.00 | 774.33983750 | 100.00 |
| Dureté de Mohs | |
| Dureté de Vickers | |
| Densité électronique #1 (g/cm3) | 5.53 |
| Indice de fermions | 0,12 |
| Indice de bosons | 0,88 |
| Photoélectricité | |
| └─ PEFornacite (barns/électron) | 998,15 |
| └─ U #2 (barns/cm3) | 5 519,7695 |
| GRapi #3 | 0 |
| Strunz 9ed. | 07 ▶ Sulfates, sélénates, tellurates, chromates, molybdates, tungstates └─ 07.F ▶ Chromates └─ 07.FC ▶ Avec PO4, AsO4, SiO4 └─ 07.FC.10 ▶ Fornacite |
| Dana 8ed. | 43 ▶ Compound Phosphates, etc └─ 43.04 ▶ Compound Phosphates, etc (Anhydres Anions composés avec Hydroxyle ou Halogène) └─ 43.04.03 ▶ Vauquelinite group └─ 43.04.03.02 ▶ Fornacite |
| CIM Hey's | |
| Lapis | VI ▶ Sulfates, chromates, molybdates, tungstates └─ VI/F ▶ Chromates [CrO4]2− └─ VI/F.02 ▶ (Indéfini) └─ VI/F.02-020 ▶ Fornacite |
| Hölzel | 7 ▶ Sulfates, chromates, molybdates, wolframates, tellurates └─ 7.F ▶ Chromates └─ 7.FB.2 ▶ (Indéfini) └─ 7.FB.220 ▶ Fornacite |
| Système cristallin | |
| └─ Notation Hermann–Mauguin | |
| └─ Règles longueurs | |
| └─ Règles angles | |
| Classe cristalline | |
| └─ Notation Hermann–Mauguin | |
| └─ Notation Schoenflies | |
| └─ Axes binaires (180°) | 0 |
| └─ Axes ternaires (120°) | 0 |
| └─ Axes quaternaires (90°) | 0 |
| └─ Axes senaires (60°) | 0 |
| └─ Plans de symétrie | 0 |
| └─ Inversion centrale | Oui |
| Groupe d'espace | |
| └─ Notation Hermann–Mauguin | |
| Groupe de plan | |
| └─ Notation Hermann–Mauguin | |
| Mailles | |
| └─ a (Å) | 8.101 |
| └─ b (Å) | 5.893 |
| └─ c (Å) | 17.547 |
| Rapport | |
| └─ Rapport a/b | 1.375 |
| └─ Rapport c/a | 2.166 |
| └─ Rapport c/b | 2.978 |
| Angles | |
| └─ α (°) | 90 |
| └─ β (°) | 110.0 |
| └─ γ (°) | 90 |
| Z #1 | 4 |
| Volume (calculé) #2 (Å3) | 787.161 |
| Densité (calculé) ρ #3 (g/cm3) | 6.534 |
| Système cristallin | |
| └─ Angle 2V | (+) |
| └─ Anisotropie | Non |
| └─ Biréfringence Maxi. | 0.100 |
| └─ Absorption | Aucune |
| └─ Pléochroïsme | Aucun |
| └─ Pléochroïsme X | Aucun |
| └─ Pléochroïsme Y | Aucun |
| └─ Pléochroïsme Z | Aucun |
| └─ Indice moyen | |
| └─ Indice α / ω / n | 2,14 |
| └─ Indice β | |
| └─ Indice γ / ε | 2,24 |
| Validation Gladstone-Dale | |
| └─ KC #1 | 0.1751 |
| └─ KPD calculé | 0.1854 |
| └─ CI #2 calculé | -0,059 ▶ Supérieur |
| └─ KPD mesuré | 0.1898 |
| └─ CI #2 mesuré | -0,084 ▶ Supérieur |
| └─ N calculé | 2.1 - 2.12 |
| Opacité |
| UV longs (365 nm) | |
| └─ Fréquence | |
| └─ Intesité | |
| └─ Couleurs | |
| └─ Autres couleurs | |
| UV moyens (320 nm) | |
| └─ Fréquence | |
| └─ Intesité | |
| └─ Couleurs | |
| └─ Autres couleurs | |
| UV courts (254 nm) | |
| └─ Fréquence | |
| └─ Intesité | |
| └─ Couleurs | |
| └─ Autres couleurs | |
| Fluorescence UV | |
| └─ Activateur principal | |
| └─ Autres activateurs |
| Handbook of mineralogy | https://handbookofmineralogy.org/pdfs/fornacite.pdf |
| Mindat | http://www.mindat.org/show.php?name=fornacite |
| Mineralienatlas | https://www.mineralienatlas.de/lexikon/index.php/MineralData?mineral=fornacite |
| RRUFF | https://rruff.net/fornacite |
| Rruff IMA | https://www.rruff.net/ima-mineral-list/?fornacite |
| Smorf Crystal Model | https://www.smorf.nl/crystals_az_naam.php?naam=f |
| Strahlen | https://www.strahlen.org/tw/fotoatlas1/fornacite_foto.html |
| Webmineral | https://webmineral.com/data/Fornacite.shtml |
| 1001 Minéraux | https://1001mineraux.com/collections/fornacite |
| Anton Waltz Minerals | https://www.awminerals.com/ |
| e-rocks | https://e-rocks.com/itemssearch?search=fornacite&op=Submit&form_id=klondike_search_quick_form |
| FossilEra | https://www.fossilera.com/minerals-for-sale/fornacite |
| Gem Select | https://www.gemselect.com/fornacite/fornacite.php |
| Gemfrance | https://www.gemfrance.com/catalogsearch/result/?q=fornacite |
| Le Comptoir Géologique (Gemmes) | https://www.le-comptoir-geologique.com/fornacite-gemme.html |
| Le Comptoir Géologique (Minéraux) | https://www.le-comptoir-geologique.com/fornacite-mineraux.html |
| Pegmatite | http://pegmatite.ru |
| Shungite.fr (La Roche Mère) | https://shungite.fr/fr/recherche?controller=search&s=fornacite |
| The Arkenstone | https://www.irocks.com/search?mode=advanced&query=fornacite&status%5B%5D=available&status%5B%5D=on-hold&status%5B%5D=sold |
| Weinrich Minerals | https://www.weinrichmineralsinc.com/product/shop/archive?name=fornacite |