| Nom | Macquartite |
| └─ Allemand (de) | Macquartit |
| └─ Anglais (en) | Macquartite |
| └─ Espagnol (es) | Macquartita |
| └─ Français (fr) | Macquartite |
| └─ IMA (im) | IMA1979-037 |
| Origine | Named for Louis Charles Henri Macquart (1745-1803), French chemist who brought to France from Russia the samples of crocoite in which the element chromium was discovered. |
| Statut | A ▶ Approuvé |
| Nom | Macquartite |
| Code | 1979-037 |
| Symbole | Mcq |
| Formule | Cu2Pb7(CrO4)4(SiO4)2(OH)2 |
| Pays | USA |
| Météorite | Non |
| Référence 1 | Bulletin de Minéralogie 103 (1980), 530 |
| Archive | 2025-11 |
| Webmineral | Pb3Cu(CrO4)(SiO3)(OH)4 |
| Mineralienatlas | Pb3Cu(CrO4)(SiO3)(OH)4 • 2(H2O) |
| Mineralienatlas (Empirique) | Pb3Cu(CrO4)(SiO3)(OH)4 • 2(H2O) |
| Rruff | Cu2+2Pb2+7(Cr6+O4)4(SiO4)2(OH)2 |
| Formule de référence | Pb3Cu(CrO4)(SiO3)(OH)4 • 2(H2O) |
| Masse atomique (u ≡ Da) | 981.3136 |
| Masse molaire #1 (g.mol-1) | 981.3136 |
| Element | Quantité | % Atomes | Masse (u ≡ Da) | Total masse (u ≡ Da) | % Masse |
|---|---|---|---|---|---|
| H | 8.00 | 29.63 | 1.00797500 | 8.06380000 | 0.82 |
| O | 13.00 | 48.15 | 15.99940000 | 207.99220000 | 21.20 |
| Si | 1.00 | 3.70 | 28.08510000 | 28.08510000 | 2.86 |
| Cr | 1.00 | 3.70 | 51.99616000 | 51.99616000 | 5.30 |
| Cu | 1.00 | 3.70 | 63.54630000 | 63.54630000 | 6.48 |
| Pb | 3.00 | 11.11 | 207.21000000 | 621.63000000 | 63.35 |
| Total | 27.00 | 100.00 | 981.31356000 | 100.00 |
| Dureté de Mohs | 3,5 |
| Dureté de Vickers | |
| Densité électronique #1 (g/cm3) | 5.02 |
| Indice de fermions | 0,14 |
| Indice de bosons | 0,86 |
| Photoélectricité | |
| └─ PEMacquartite (barns/électron) | 1 127,25 |
| └─ U #2 (barns/cm3) | 5 658,795 |
| GRapi #3 | 0 |
| Strunz 9ed. | 09 ▶ Silicates └─ 09.H ▶ Silicates non classifiés └─ 09.HH ▶ Avec Pb └─ 09.HH.05 ▶ Macquartite |
| Dana 8ed. | 36 ▶ Compound Chromates └─ 36.01 ▶ Compound Chromates avec formules diverses └─ 36.01.02 ▶ (Indéfini) └─ 36.01.02.01 ▶ Macquartite |
| CIM Hey's | |
| Lapis | VIII ▶ Silicates └─ VIII/B ▶ Inselsilicates avec anions étrangers au tétraèdre (néso-subsilikates) └─ VIII/B.28 ▶ Cations avec nombres de coordination entre [8] et [12] ; silicates en îlots avec groupes [SO4]2-, [CrO4]2- et [PO4]3- └─ VIII/B.28-030 ▶ Macquartite |
| Hölzel | 9 ▶ Silicates (germanates) └─ 9.G ▶ Structures inconnues └─ 9.GH.1 ▶ (Indéfini) └─ 9.GH.100 ▶ Macquartite |
| Système cristallin | |
| └─ Notation Hermann–Mauguin | |
| └─ Règles longueurs | |
| └─ Règles angles | |
| Classe cristalline | |
| └─ Notation Hermann–Mauguin | |
| └─ Notation Schoenflies | |
| └─ Axes binaires (180°) | 0 |
| └─ Axes ternaires (120°) | 0 |
| └─ Axes quaternaires (90°) | 0 |
| └─ Axes senaires (60°) | 0 |
| └─ Plans de symétrie | 0 |
| └─ Inversion centrale | Oui |
| Groupe d'espace | |
| └─ Notation Hermann–Mauguin | |
| Groupe de plan | |
| └─ Notation Hermann–Mauguin | |
| Mailles | |
| └─ a (Å) | 20.81 |
| └─ b (Å) | 5.84 |
| └─ c (Å) | 9.26 |
| Rapport | |
| └─ Rapport a/b | 3.563 |
| └─ Rapport c/a | 0.445 |
| └─ Rapport c/b | 1.586 |
| Angles | |
| └─ α (°) | 90 |
| └─ β (°) | 91.80 |
| └─ γ (°) | 90 |
| Z #1 | 4 |
| Volume (calculé) #2 (Å3) | 1124.816 |
| Densité (calculé) ρ #3 (g/cm3) | 5.795 |
| Système cristallin | |
| └─ Angle 2V | (-) |
| └─ Angle mesuré (°) | 85° |
| └─ Anisotropie | Non |
| └─ Biréfringence Maxi. | 0.060 |
| └─ Absorption | Aucune |
| └─ Pléochroïsme | Aucun |
| └─ Pléochroïsme X | Aucun |
| └─ Pléochroïsme Y | Aucun |
| └─ Pléochroïsme Z | Aucun |
| └─ Indice moyen | 2,31 |
| └─ Indice α / ω / n | nα = 2,28 |
| └─ Indice β | nβ = 2,31 |
| └─ Indice γ / ε | nγ = 2,34 |
| Validation Gladstone-Dale | |
| └─ KC #1 | 0.1764 |
| └─ KPD calculé | 0.2263 |
| └─ CI #2 calculé | -0,283 ▶ Supérieur |
| └─ KPD mesuré | 0.2386 |
| └─ CI #2 mesuré | -0,353 ▶ Supérieur |
| └─ N calculé | 1.97 - 2.02 |
| Opacité |
| UV longs (365 nm) | |
| └─ Fréquence | |
| └─ Intesité | |
| └─ Couleurs | |
| └─ Autres couleurs | |
| UV moyens (320 nm) | |
| └─ Fréquence | |
| └─ Intesité | |
| └─ Couleurs | |
| └─ Autres couleurs | |
| UV courts (254 nm) | |
| └─ Fréquence | |
| └─ Intesité | |
| └─ Couleurs | |
| └─ Autres couleurs | |
| Fluorescence UV | |
| └─ Activateur principal | |
| └─ Autres activateurs |
| Handbook of mineralogy | https://handbookofmineralogy.org/pdfs/macquartite.pdf |
| Mindat | http://www.mindat.org/show.php?name=macquartite |
| Mineralienatlas | https://www.mineralienatlas.de/lexikon/index.php/MineralData?mineral=macquartite |
| RRUFF | https://rruff.net/macquartite |
| Rruff IMA | https://www.rruff.net/ima-mineral-list/?macquartite |
| Smorf Crystal Model | https://www.smorf.nl/crystals_az_naam.php?naam=m |
| Strahlen | https://www.strahlen.org/tw/fotoatlas1/macquartite_foto.html |
| Webmineral | https://webmineral.com/data/Macquartite.shtml |
| 1001 Minéraux | https://1001mineraux.com/collections/macquartite |
| Anton Waltz Minerals | https://www.awminerals.com/ |
| e-rocks | https://e-rocks.com/itemssearch?search=macquartite&op=Submit&form_id=klondike_search_quick_form |
| FossilEra | https://www.fossilera.com/minerals-for-sale/macquartite |
| Gem Select | https://www.gemselect.com/macquartite/macquartite.php |
| Gemfrance | https://www.gemfrance.com/catalogsearch/result/?q=macquartite |
| Le Comptoir Géologique (Gemmes) | https://www.le-comptoir-geologique.com/macquartite-gemme.html |
| Le Comptoir Géologique (Minéraux) | https://www.le-comptoir-geologique.com/macquartite-mineraux.html |
| Pegmatite | http://pegmatite.ru |
| Shungite.fr (La Roche Mère) | https://shungite.fr/fr/recherche?controller=search&s=macquartite |
| The Arkenstone | https://www.irocks.com/search?mode=advanced&query=macquartite&status%5B%5D=available&status%5B%5D=on-hold&status%5B%5D=sold |
| Weinrich Minerals | https://www.weinrichmineralsinc.com/product/shop/archive?name=macquartite |