| Nom | Corkite |
| └─ Allemand (de) | Corkit |
| └─ Allemand (de) | Dernbachit |
| └─ Allemand (de) | Korkit |
| └─ Allemand (de) | Phosphorbeudantit |
| └─ Anglais (en) | Corkite |
| └─ Chinois (zh) | 磷硫鋁鐵礦 |
| └─ Chinois (zh) | 磷硫铝铁矿 |
| └─ Espagnol (es) | Corkita |
| └─ Espagnol (es) | Dernbachita |
| └─ Français (fr) | Corkite |
| └─ Japonais (ja) | コーク石 |
| └─ Russe (ru) | Коркит |
| Origine | Named for the locality. LOCALITY: Glandore iron mines, Co. Cork, Ireland. |
| Statut | Rd ▶ Redéfini |
| Nom | Corkite |
| Code | 1987 s.p. |
| Symbole | Cok |
| Formule | PbFe3+3(SO4)(PO4)(OH)6 |
| Pays | IRL |
| Météorite | Non |
| Référence 1 | Annales des Mines 15 (1869), 405 |
| Référence 2 | Neues Jahrbuch für Mineralogie Abhandlungen 185 (2009), 313 |
| Archive | 2025-11 |
| Webmineral | PbFe+++3(PO4)(SO4)(OH)6 |
| Mineralienatlas | PbFe33+(PO4)(SO4)(OH)6 |
| Mineralienatlas (Empirique) | PbFe3(PO4)(SO4)(OH)6 |
| Rruff | Pb2+Fe3+3(S6+O4)(PO4)(OH)6 |
| Formule de référence | PbFe3(PO4)(SO4)(OH)6 |
| Masse atomique (u ≡ Da) | 667.8263 |
| Masse molaire #1 (g.mol-1) | 667.8263 |
| Element | Quantité | % Atomes | Masse (u ≡ Da) | Total masse (u ≡ Da) | % Masse |
|---|---|---|---|---|---|
| H | 6.00 | 23.08 | 1.00797500 | 6.04785000 | 0.91 |
| O | 14.00 | 53.85 | 15.99940000 | 223.99160000 | 33.54 |
| P | 1.00 | 3.85 | 30.97376200 | 30.97376200 | 4.64 |
| S | 1.00 | 3.85 | 32.06750000 | 32.06750000 | 4.80 |
| Fe | 3.00 | 11.54 | 55.84520000 | 167.53560000 | 25.09 |
| Pb | 1.00 | 3.85 | 207.21000000 | 207.21000000 | 31.03 |
| Total | 26.00 | 100.00 | 667.82631200 | 100.00 |
| Dureté de Mohs | 3,5 - 4,5 |
| Dureté de Vickers | |
| Densité électronique #1 (g/cm3) | 3.97 |
| Indice de fermions | 0,07 |
| Indice de bosons | 0,93 |
| Photoélectricité | |
| └─ PECorkite (barns/électron) | 523,15 |
| └─ U #2 (barns/cm3) | 2 076,9055 |
| GRapi #3 | 0 |
| Strunz 9ed. | 08 ▶ Phosphates, arséniates, vanadates └─ 08.B ▶ Phosphates, etc. avec anions additionnels, sans H2O └─ 08.BL ▶ Avec medium-sized and large cations, (OH, etc) : RO4 = 3:1 └─ 08.BL.05 ▶ Corkite |
| Dana 8ed. | 43 ▶ Compound Phosphates, etc └─ 43.04 ▶ Compound Phosphates, etc (Anhydres Anions composés avec Hydroxyle ou Halogène) └─ 43.04.01 ▶ Beudantite group └─ 43.04.01.02 ▶ Corkite |
| CIM Hey's | |
| Lapis | VII ▶ Phosphates et arsénates (« phosphates » incluent toujours les arsénates et les vanadates isotypes) └─ VII/B ▶ Phosphates anhydres, avec anions étrangers F, Cl, O, OH └─ VII/B.35 ▶ Cations moyens et gros : Mg–Cu–Zn et Ca–Na–K–Ba–Pb ; groupe du beudantite └─ VII/B.35-080 ▶ Corkite |
| Hölzel | 7 ▶ Sulfates, chromates, molybdates, wolframates, tellurates └─ 7.B ▶ Sulfates (sélénates, etc.) avec autres anions, sans H2O └─ 7.BC.2 ▶ Beudantites avec Pb └─ 7.BC.220 ▶ Corkite |
| Système cristallin | Trigonal ≡ Rhombohedral |
| └─ Notation Hermann–Mauguin | 3m |
| └─ Règles longueurs | a = b ≠ c |
| └─ Règles angles | α = β = 90°, γ = 120° |
| Classe cristalline | Trigonal pyramidal trigonale |
| └─ Notation Hermann–Mauguin | 3m |
| └─ Notation Schoenflies | C3v |
| └─ Axes binaires (180°) | 0 |
| └─ Axes ternaires (120°) | 1 |
| └─ Axes quaternaires (90°) | 0 |
| └─ Axes senaires (60°) | 0 |
| └─ Plans de symétrie | 1 |
| └─ Inversion centrale | Oui |
| Groupe d'espace | 160 |
| └─ Notation Hermann–Mauguin | R3m |
| Groupe de plan | |
| └─ Notation Hermann–Mauguin | |
| Mailles | |
| └─ a (Å) | 7.280 |
| └─ b (Å) | (Indéfini) |
| └─ c (Å) | 16.821 |
| Rapport | |
| └─ Rapport a/b | |
| └─ Rapport c/a | 2.311 |
| └─ Rapport c/b | |
| Angles | |
| └─ α (°) | 90 |
| └─ β (°) | 90 |
| └─ γ (°) | 120 |
| Z #1 | 3 |
| Volume (calculé) #2 (Å3) | |
| Densité (calculé) ρ #3 (g/cm3) |
| Système cristallin | Trigonal ≡ Rhombohedral |
| └─ Angle 2V | Uniaxe (-) |
| └─ Anisotropie | Oui |
| └─ Biréfringence Maxi. | 0.010 |
| └─ Absorption (E/O) | |
| └─ Pléochroïsme | |
| └─ Pléochroïsme X | |
| └─ Pléochroïsme Y | |
| └─ Pléochroïsme Z | |
| └─ Indice moyen | 1,927 |
| └─ Indice α / ω / n | 1,93 |
| └─ Indice β | |
| └─ Indice γ / ε | 1,92 |
| Validation Gladstone-Dale | |
| └─ KC #1 | 0.2256 |
| └─ KPD calculé | 0.2104 |
| └─ CI #2 calculé | 0,067 ▶ Correct |
| └─ KPD mesuré | 0.2165 |
| └─ CI #2 mesuré | 0,04 ▶ Bon |
| └─ N calculé | 1.97 - 2 |
| Opacité |
| UV longs (365 nm) | |
| └─ Fréquence | |
| └─ Intesité | |
| └─ Couleurs | |
| └─ Autres couleurs | |
| UV moyens (320 nm) | |
| └─ Fréquence | |
| └─ Intesité | |
| └─ Couleurs | |
| └─ Autres couleurs | |
| UV courts (254 nm) | |
| └─ Fréquence | |
| └─ Intesité | |
| └─ Couleurs | |
| └─ Autres couleurs | |
| Fluorescence UV | |
| └─ Activateur principal | |
| └─ Autres activateurs |
| Handbook of mineralogy | https://handbookofmineralogy.org/pdfs/corkite.pdf |
| Mindat | http://www.mindat.org/show.php?name=corkite |
| Mineralienatlas | https://www.mineralienatlas.de/lexikon/index.php/MineralData?mineral=corkite |
| RRUFF | https://rruff.net/corkite |
| Rruff IMA | https://www.rruff.net/ima-mineral-list/?corkite |
| Smorf Crystal Model | https://www.smorf.nl/crystals_az_naam.php?naam=c |
| Strahlen | https://www.strahlen.org/tw/fotoatlas1/corkite_foto.html |
| Webmineral | https://webmineral.com/data/Corkite.shtml |
| 1001 Minéraux | https://1001mineraux.com/collections/corkite |
| Anton Waltz Minerals | https://www.awminerals.com/ |
| e-rocks | https://e-rocks.com/itemssearch?search=corkite&op=Submit&form_id=klondike_search_quick_form |
| FossilEra | https://www.fossilera.com/minerals-for-sale/corkite |
| Gem Select | https://www.gemselect.com/corkite/corkite.php |
| Gemfrance | https://www.gemfrance.com/catalogsearch/result/?q=corkite |
| Le Comptoir Géologique (Gemmes) | https://www.le-comptoir-geologique.com/corkite-gemme.html |
| Le Comptoir Géologique (Minéraux) | https://www.le-comptoir-geologique.com/corkite-mineraux.html |
| Pegmatite | http://pegmatite.ru |
| Shungite.fr (La Roche Mère) | https://shungite.fr/fr/recherche?controller=search&s=corkite |
| The Arkenstone | https://www.irocks.com/search?mode=advanced&query=corkite&status%5B%5D=available&status%5B%5D=on-hold&status%5B%5D=sold |
| Weinrich Minerals | https://www.weinrichmineralsinc.com/product/shop/archive?name=corkite |