| Nom | Leogangite |
| └─ Allemand (de) | Leogangit |
| └─ Anglais (en) | Leogangite |
| └─ Chinois (zh) | 水羟硫砷铜石 |
| └─ Chinois (zh) | 水羥硫砷銅石 |
| └─ Espagnol (es) | Leogangita |
| └─ Français (fr) | Leogangite |
| └─ IMA (im) | IMA1998-032 |
| └─ Russe (ru) | Леогангит |
| Origine | Named for the locality. LOCALITY: A mine dump of the Danielstollen, in the Schwarzleo valley about 10 km west-southwest of Leogang, Salzburg, Austria. |
| Statut | A ▶ Approuvé |
| Nom | Leogangite |
| Code | 1998-032 |
| Symbole | Lgg |
| Formule | Cu10(AsO4)4(SO4)(OH)6(H2O)4 • 4H2O |
| Pays | AUT |
| Météorite | Non |
| Référence 1 | Mineralogy and Petrology 81 (2004), 187 |
| Archive | 2025-11 |
| Webmineral | Cu10(AsO4)4(SO4)(OH)6 |
| Mineralienatlas | Cu10[(OH)6|SO4|(AsO4)4] • 8H2O |
| Mineralienatlas (Empirique) | Cu10[(OH)6SO4(AsO4)4] • 8H2O |
| Rruff | Cu2+10(As5+O4)4S6+O4(OH)6 • 8H2O |
| Formule de référence | Cu10[(OH)6SO4(AsO4)4] • 8H2O |
| Masse atomique (u ≡ Da) | 1533.3719 |
| Masse molaire #1 (g.mol-1) | 1533.3719 |
| Element | Quantité | % Atomes | Masse (u ≡ Da) | Total masse (u ≡ Da) | % Masse |
|---|---|---|---|---|---|
| H | 22.00 | 30.99 | 1.00797500 | 22.17545000 | 1.45 |
| O | 34.00 | 47.89 | 15.99940000 | 543.97960000 | 35.48 |
| S | 1.00 | 1.41 | 32.06750000 | 32.06750000 | 2.09 |
| Cu | 10.00 | 14.08 | 63.54630000 | 635.46300000 | 41.44 |
| As | 4.00 | 5.63 | 74.92159500 | 299.68638000 | 19.54 |
| Total | 71.00 | 100.00 | 1533.37193000 | 100.00 |
| Dureté de Mohs | 2 |
| Dureté de Vickers | |
| Densité électronique #1 (g/cm3) | 3.42 |
| Indice de fermions | 0,0004 |
| Indice de bosons | 0,9996 |
| Photoélectricité | |
| └─ PELeogangite (barns/électron) | 31,2 |
| └─ U #2 (barns/cm3) | 106,704 |
| GRapi #3 | 0 |
| Strunz 9ed. | 08 ▶ Phosphates, arséniates, vanadates └─ 08.C ▶ Phosphates sans anions additionnels, avec H2O └─ 08.CC ▶ Avec only medium-sized cations, RO4 : H2O = 1:1.5 └─ 08.CC.15 ▶ Leogangite |
| Dana 8ed. | 43 ▶ Compound Phosphates, etc └─ 43.05 ▶ Compound Phosphates, etc (Hydratés Anions composés avec Hydroxyle ou Halogène) └─ 43.05.23 ▶ (Indéfini) └─ 43.05.23.01 ▶ Leogangite |
| CIM Hey's | |
| Lapis | VII ▶ Phosphates et arsénates (« phosphates » incluent toujours les arsénates et les vanadates isotypes) └─ VII/D ▶ Phosphates hydratés, avec anions étrangers └─ VII/D.20 ▶ Cations moyens : Cu–Zn–Mn–Al–Fe └─ VII/D.20-035 ▶ Leogangite |
| Hölzel | 8 ▶ Phosphates, arsénates, vanadates └─ 8.D ▶ Phosphates avec autres anions, avec H2O └─ 8.DB.9 ▶ (Indéfini) └─ 8.DB.920 ▶ Leogangite |
| Système cristallin | Monoclinique |
| └─ Notation Hermann–Mauguin | 2/m |
| └─ Règles longueurs | a ≠ b ≠ c |
| └─ Règles angles | α = γ = 90°, β ≠ 90° |
| Classe cristalline | Monoclinique dipyramidal #5 |
| └─ Notation Hermann–Mauguin | 2/m |
| └─ Notation Schoenflies | C2h |
| └─ Axes binaires (180°) | 1 |
| └─ Axes ternaires (120°) | 0 |
| └─ Axes quaternaires (90°) | 0 |
| └─ Axes senaires (60°) | 0 |
| └─ Plans de symétrie | 1 |
| └─ Inversion centrale | Oui |
| Groupe d'espace | 15 |
| └─ Notation Hermann–Mauguin | C2/c |
| Groupe de plan | |
| └─ Notation Hermann–Mauguin | |
| Mailles | |
| └─ a (Å) | 21.778 |
| └─ b (Å) | 12.317 |
| └─ c (Å) | 10.716 |
| Rapport | |
| └─ Rapport a/b | 1.768 |
| └─ Rapport c/a | 0.492 |
| └─ Rapport c/b | 0.870 |
| Angles | |
| └─ α (°) | 90 |
| └─ β (°) | 92.82 |
| └─ γ (°) | 90 |
| Z #1 | 4 |
| Volume (calculé) #2 (Å3) | 2870.975 |
| Densité (calculé) ρ #3 (g/cm3) | 3.548 |
| Système cristallin | Monoclinique |
| └─ Angle 2V | Biaxe (-) |
| └─ Angle (°) | 18° |
| └─ Anisotropie | Oui |
| └─ Biréfringence Maxi. | 0.154 |
| └─ Absorption (X/Y/Z) | |
| └─ Pléochroïsme | |
| └─ Pléochroïsme X | |
| └─ Pléochroïsme Y | |
| └─ Pléochroïsme Z | |
| └─ Indice moyen | 1,691 |
| └─ Indice α / ω / n | 1,59 |
| └─ Indice β | 1,74 |
| └─ Indice γ / ε | 1,744 |
| Validation Gladstone-Dale | |
| └─ KC #1 | 0.1824 |
| └─ KPD calculé | 0.1937 |
| └─ CI #2 calculé | -0,062 ▶ Supérieur |
| └─ KPD mesuré | |
| └─ CI #2 mesuré | |
| └─ N calculé | |
| Opacité |
| UV longs (365 nm) | |
| └─ Fréquence | |
| └─ Intesité | |
| └─ Couleurs | |
| └─ Autres couleurs | |
| UV moyens (320 nm) | |
| └─ Fréquence | |
| └─ Intesité | |
| └─ Couleurs | |
| └─ Autres couleurs | |
| UV courts (254 nm) | |
| └─ Fréquence | |
| └─ Intesité | |
| └─ Couleurs | |
| └─ Autres couleurs | |
| Fluorescence UV | |
| └─ Activateur principal | |
| └─ Autres activateurs |
| Handbook of mineralogy | https://handbookofmineralogy.org/pdfs/leogangite.pdf |
| Mindat | http://www.mindat.org/show.php?name=leogangite |
| Mineralienatlas | https://www.mineralienatlas.de/lexikon/index.php/MineralData?mineral=leogangite |
| RRUFF | https://rruff.net/leogangite |
| Rruff IMA | https://www.rruff.net/ima-mineral-list/?leogangite |
| Smorf Crystal Model | https://www.smorf.nl/crystals_az_naam.php?naam=l |
| Strahlen | https://www.strahlen.org/tw/fotoatlas1/leogangite_foto.html |
| Webmineral | https://webmineral.com/data/Leogangite.shtml |
| 1001 Minéraux | https://1001mineraux.com/collections/leogangite |
| Anton Waltz Minerals | https://www.awminerals.com/ |
| e-rocks | https://e-rocks.com/itemssearch?search=leogangite&op=Submit&form_id=klondike_search_quick_form |
| FossilEra | https://www.fossilera.com/minerals-for-sale/leogangite |
| Gem Select | https://www.gemselect.com/leogangite/leogangite.php |
| Gemfrance | https://www.gemfrance.com/catalogsearch/result/?q=leogangite |
| Le Comptoir Géologique (Gemmes) | https://www.le-comptoir-geologique.com/leogangite-gemme.html |
| Le Comptoir Géologique (Minéraux) | https://www.le-comptoir-geologique.com/leogangite-mineraux.html |
| Pegmatite | http://pegmatite.ru |
| Shungite.fr (La Roche Mère) | https://shungite.fr/fr/recherche?controller=search&s=leogangite |
| The Arkenstone | https://www.irocks.com/search?mode=advanced&query=leogangite&status%5B%5D=available&status%5B%5D=on-hold&status%5B%5D=sold |
| Weinrich Minerals | https://www.weinrichmineralsinc.com/product/shop/archive?name=leogangite |