| Nom | Hidalgoite |
| └─ Allemand (de) | Hidalgoit |
| └─ Anglais (en) | Hidalgoite |
| └─ Chinois (zh) | 砷铝铅矾 |
| └─ Espagnol (es) | Hidalgoíta |
| └─ Français (fr) | Hidalgoite |
| └─ Russe (ru) | Хидальгоит |
| Origine | Named for the locality. LOCALITY: San Pascual mine, nine km northwest of Zimapan, Hidalgo, Mexico. |
| Statut | Rd ▶ Redéfini |
| Nom | Hidalgoite |
| Code | 1987 s.p. |
| Symbole | Hid |
| Formule | PbAl3(SO4)(AsO4)(OH)6 |
| Pays | MEX |
| Météorite | Non |
| Référence 1 | American Mineralogist 38 (1953), 1218 |
| Référence 2 | Mineralogical Magazine 76 (2012), 839 |
| Archive | 2025-11 |
| Webmineral | PbAl3(AsO4)(SO4)(OH)6 |
| Mineralienatlas | PbAl3(AsO4)(SO4)(OH)6 |
| Mineralienatlas (Empirique) | PbAl3(AsO4)(SO4)(OH)6 |
| Rruff | Pb2+Al3(S6+O4)(As5+O4)(OH)6 |
| Formule de référence | PbAl3(AsO4)(SO4)(OH)6 |
| Masse atomique (u ≡ Da) | 625.1832 |
| Masse molaire #1 (g.mol-1) | 625.1832 |
| Element | Quantité | % Atomes | Masse (u ≡ Da) | Total masse (u ≡ Da) | % Masse |
|---|---|---|---|---|---|
| H | 6.00 | 23.08 | 1.00797500 | 6.04785000 | 0.97 |
| O | 14.00 | 53.85 | 15.99940000 | 223.99160000 | 35.83 |
| Al | 3.00 | 11.54 | 26.98153850 | 80.94461550 | 12.95 |
| S | 1.00 | 3.85 | 32.06750000 | 32.06750000 | 5.13 |
| As | 1.00 | 3.85 | 74.92159500 | 74.92159500 | 11.98 |
| Pb | 1.00 | 3.85 | 207.21000000 | 207.21000000 | 33.14 |
| Total | 26.00 | 100.00 | 625.18316050 | 100.00 |
| Dureté de Mohs | 4,5 |
| Dureté de Vickers | |
| Densité électronique #1 (g/cm3) | 3.65 |
| Indice de fermions | 0,07 |
| Indice de bosons | 0,93 |
| Photoélectricité | |
| └─ PEHidalgoite (barns/électron) | 561,4 |
| └─ U #2 (barns/cm3) | 2 049,11 |
| GRapi #3 | 0 |
| Strunz 9ed. | 08 ▶ Phosphates, arséniates, vanadates └─ 08.B ▶ Phosphates, etc. avec anions additionnels, sans H2O └─ 08.BL ▶ Avec medium-sized and large cations, (OH, etc) : RO4 = 3:1 └─ 08.BL.05 ▶ Hidalgoite |
| Dana 8ed. | 43 ▶ Compound Phosphates, etc └─ 43.04 ▶ Compound Phosphates, etc (Anhydres Anions composés avec Hydroxyle ou Halogène) └─ 43.04.01 ▶ Beudantite group └─ 43.04.01.03 ▶ Hidalgoite |
| CIM Hey's | |
| Lapis | VII ▶ Phosphates et arsénates (« phosphates » incluent toujours les arsénates et les vanadates isotypes) └─ VII/B ▶ Phosphates anhydres, avec anions étrangers F, Cl, O, OH └─ VII/B.35 ▶ Cations moyens et gros : Mg–Cu–Zn et Ca–Na–K–Ba–Pb ; groupe du beudantite └─ VII/B.35-070 ▶ Hidalgoite |
| Hölzel | 7 ▶ Sulfates, chromates, molybdates, wolframates, tellurates └─ 7.B ▶ Sulfates (sélénates, etc.) avec autres anions, sans H2O └─ 7.BC.2 ▶ Beudantites avec Pb └─ 7.BC.200 ▶ Hidalgoite |
| Système cristallin | |
| └─ Notation Hermann–Mauguin | |
| └─ Règles longueurs | |
| └─ Règles angles | |
| Classe cristalline | |
| └─ Notation Hermann–Mauguin | |
| └─ Notation Schoenflies | |
| └─ Axes binaires (180°) | 0 |
| └─ Axes ternaires (120°) | 0 |
| └─ Axes quaternaires (90°) | 0 |
| └─ Axes senaires (60°) | 0 |
| └─ Plans de symétrie | 0 |
| └─ Inversion centrale | Oui |
| Groupe d'espace | |
| └─ Notation Hermann–Mauguin | |
| Groupe de plan | |
| └─ Notation Hermann–Mauguin | |
| Mailles | |
| └─ a (Å) | 7.04 |
| └─ b (Å) | (Indéfini) |
| └─ c (Å) | 16.99 |
| Rapport | |
| └─ Rapport a/b | |
| └─ Rapport c/a | 2.413 |
| └─ Rapport c/b | |
| Angles | |
| └─ α (°) | 90 |
| └─ β (°) | 90 |
| └─ γ (°) | 120 |
| Z #1 | 3 |
| Volume (calculé) #2 (Å3) | |
| Densité (calculé) ρ #3 (g/cm3) |
| Système cristallin | |
| └─ Angle 2V | |
| └─ Anisotropie | Non |
| └─ Biréfringence Maxi. | |
| └─ Absorption | Aucune |
| └─ Pléochroïsme | Aucun |
| └─ Pléochroïsme X | Aucun |
| └─ Pléochroïsme Y | Aucun |
| └─ Pléochroïsme Z | Aucun |
| └─ Indice moyen | 1,709 |
| └─ Indice α / ω / n | 1,705 |
| └─ Indice β | |
| └─ Indice γ / ε | 1,713 |
| Validation Gladstone-Dale | |
| └─ KC #1 | 0.18 |
| └─ KPD calculé | 0.167 |
| └─ CI #2 calculé | 0,072 ▶ Correct |
| └─ KPD mesuré | 0.1801 |
| └─ CI #2 mesuré | -0,001 ▶ Supérieur |
| └─ N calculé | 1.71 - 1.77 |
| Opacité |
| UV longs (365 nm) | |
| └─ Fréquence | |
| └─ Intesité | |
| └─ Couleurs | |
| └─ Autres couleurs | |
| UV moyens (320 nm) | |
| └─ Fréquence | |
| └─ Intesité | |
| └─ Couleurs | |
| └─ Autres couleurs | |
| UV courts (254 nm) | |
| └─ Fréquence | |
| └─ Intesité | |
| └─ Couleurs | |
| └─ Autres couleurs | |
| Fluorescence UV | |
| └─ Activateur principal | |
| └─ Autres activateurs |
| Handbook of mineralogy | https://handbookofmineralogy.org/pdfs/hidalgoite.pdf |
| Mindat | http://www.mindat.org/show.php?name=hidalgoite |
| Mineralienatlas | https://www.mineralienatlas.de/lexikon/index.php/MineralData?mineral=hidalgoite |
| RRUFF | https://rruff.net/hidalgoite |
| Rruff IMA | https://www.rruff.net/ima-mineral-list/?hidalgoite |
| Smorf Crystal Model | https://www.smorf.nl/crystals_az_naam.php?naam=h |
| Strahlen | https://www.strahlen.org/tw/fotoatlas1/hidalgoite_foto.html |
| Webmineral | https://webmineral.com/data/Hidalgoite.shtml |
| 1001 Minéraux | https://1001mineraux.com/collections/hidalgoite |
| Anton Waltz Minerals | https://www.awminerals.com/ |
| e-rocks | https://e-rocks.com/itemssearch?search=hidalgoite&op=Submit&form_id=klondike_search_quick_form |
| FossilEra | https://www.fossilera.com/minerals-for-sale/hidalgoite |
| Gem Select | https://www.gemselect.com/hidalgoite/hidalgoite.php |
| Gemfrance | https://www.gemfrance.com/catalogsearch/result/?q=hidalgoite |
| Le Comptoir Géologique (Gemmes) | https://www.le-comptoir-geologique.com/hidalgoite-gemme.html |
| Le Comptoir Géologique (Minéraux) | https://www.le-comptoir-geologique.com/hidalgoite-mineraux.html |
| Pegmatite | http://pegmatite.ru |
| Shungite.fr (La Roche Mère) | https://shungite.fr/fr/recherche?controller=search&s=hidalgoite |
| The Arkenstone | https://www.irocks.com/search?mode=advanced&query=hidalgoite&status%5B%5D=available&status%5B%5D=on-hold&status%5B%5D=sold |
| Weinrich Minerals | https://www.weinrichmineralsinc.com/product/shop/archive?name=hidalgoite |