| Nom | Tatarskite |
| └─ Allemand (de) | Tatarskit |
| └─ Anglais (en) | Tatarskite |
| └─ Espagnol (es) | Tatarskita |
| └─ Français (fr) | Tatarskite |
| └─ Russe (ru) | Татарскит |
| Origine | Named for Vitalii Borisovich Tatarskii (1907-), Russian mineralogist, Leningrad University. |
| Statut | A ▶ Approuvé |
| Nom | Tatarskite |
| Code | 1967 s.p. |
| Symbole | Tts |
| Formule | Ca6Mg2(SO4)2(CO3)2(OH)4Cl4 • 7H2O |
| Pays | RUS |
| Météorite | Non |
| Référence 1 | Zapiski Vsesoyuznogo Mineralogicheskogo Obshchestva 92 (1963), 697 |
| Archive | 2025-11 |
| Webmineral | Ca6Mg2(SO4)2(CO3)2Cl4(OH)4 |
| Mineralienatlas | Ca6Mg2(SO4)2(CO3)2Cl4(OH)4 • 7H2O |
| Mineralienatlas (Empirique) | Ca6Mg2(SO4)2(CO3)2Cl4(OH)4 • 7H2O |
| Rruff | Ca6Mg2(S6+O4)2(CO3)2(OH)4Cl4 • 7H2O |
| Formule de référence | Ca6Mg2(SO4)2(CO3)2Cl4(OH)4 • 7H2O |
| Masse atomique (u ≡ Da) | 937.1722 |
| Masse molaire #1 (g.mol-1) | 937.1722 |
| Element | Quantité | % Atomes | Masse (u ≡ Da) | Total masse (u ≡ Da) | % Masse |
|---|---|---|---|---|---|
| H | 18.00 | 30.51 | 1.00797500 | 18.14355000 | 1.94 |
| C | 2.00 | 3.39 | 12.01060000 | 24.02120000 | 2.56 |
| O | 25.00 | 42.37 | 15.99940000 | 399.98500000 | 42.68 |
| Mg | 2.00 | 3.39 | 24.30550000 | 48.61100000 | 5.19 |
| S | 2.00 | 3.39 | 32.06750000 | 64.13500000 | 6.84 |
| Cl | 4.00 | 6.78 | 35.45150000 | 141.80600000 | 15.13 |
| Ca | 6.00 | 10.17 | 40.07840000 | 240.47040000 | 25.66 |
| Total | 59.00 | 100.00 | 937.17215000 | 100.00 |
| Dureté de Mohs | 2,5 |
| Dureté de Vickers | |
| Densité électronique #1 (g/cm3) | 2.37 |
| Indice de fermions | 0,0065 |
| Indice de bosons | 0,9935 |
| Photoélectricité | |
| └─ PETatarskite (barns/électron) | 4,67 |
| └─ U #2 (barns/cm3) | 11,0679 |
| GRapi #3 | 0 |
| Strunz 9ed. | 07 ▶ Sulfates, sélénates, tellurates, chromates, molybdates, tungstates └─ 07.D ▶ Sulfates (selenates, etc.) avec anions additionnels, avec H2O └─ 07.DG ▶ Avec large and medium sized cations; avec NO3, CO3, B(OH)4, SiO4 ou IO3 └─ 07.DG.25 ▶ Tatarskite |
| Dana 8ed. | 32 ▶ Compound Sulfates └─ 32.04 ▶ Compound Sulfates (hydrous) avec poly-anionic formula └─ 32.04.02 ▶ (Indéfini) └─ 32.04.02.01 ▶ Tatarskite |
| CIM Hey's | |
| Lapis | VI ▶ Sulfates, chromates, molybdates, tungstates └─ VI/D ▶ Sulfates hydratés, avec anions étrangers └─ VI/D.19 ▶ Cations moyens et très gros └─ VI/D.19-040 ▶ Tatarskite |
| Hölzel | 7 ▶ Sulfates, chromates, molybdates, wolframates, tellurates └─ 7.D ▶ Sulfates (sélénates, etc.) avec autres anions, avec H2O └─ 7.DO.2 ▶ (Indéfini) └─ 7.DO.200 ▶ Tatarskite |
| Système cristallin | |
| └─ Notation Hermann–Mauguin | |
| └─ Règles longueurs | |
| └─ Règles angles | |
| Classe cristalline | |
| └─ Notation Hermann–Mauguin | |
| └─ Notation Schoenflies | |
| └─ Axes binaires (180°) | 0 |
| └─ Axes ternaires (120°) | 0 |
| └─ Axes quaternaires (90°) | 0 |
| └─ Axes senaires (60°) | 0 |
| └─ Plans de symétrie | 0 |
| └─ Inversion centrale | Oui |
| Groupe d'espace | |
| └─ Notation Hermann–Mauguin | |
| Groupe de plan | |
| └─ Notation Hermann–Mauguin | |
| Mailles | |
| └─ a (Å) | (Indéfini) |
| └─ b (Å) | (Indéfini) |
| └─ c (Å) | (Indéfini) |
| Rapport | |
| └─ Rapport a/b | |
| └─ Rapport c/a | |
| └─ Rapport c/b | |
| Angles | |
| └─ α (°) | 90 |
| └─ β (°) | 90 |
| └─ γ (°) | 90 |
| Z #1 | |
| Volume (calculé) #2 (Å3) | |
| Densité (calculé) ρ #3 (g/cm3) |
| Système cristallin | |
| └─ Angle 2V | (-) |
| └─ Angle (°) | 83° |
| └─ Anisotropie | Non |
| └─ Biréfringence Maxi. | 0.155 |
| └─ Absorption | Aucune |
| └─ Pléochroïsme | Aucun |
| └─ Pléochroïsme X | Aucun |
| └─ Pléochroïsme Y | Aucun |
| └─ Pléochroïsme Z | Aucun |
| └─ Indice moyen | 1,648 |
| └─ Indice α / ω / n | 1,567 |
| └─ Indice β | 1,654 |
| └─ Indice γ / ε | 1,722 |
| Validation Gladstone-Dale | |
| └─ KC #1 | 0.2493 |
| └─ KPD calculé | |
| └─ CI #2 calculé | |
| └─ KPD mesuré | 0.2767 |
| └─ CI #2 mesuré | -0,11 ▶ Supérieur |
| └─ N calculé | |
| Opacité |
| UV longs (365 nm) | |
| └─ Fréquence | |
| └─ Intesité | |
| └─ Couleurs | |
| └─ Autres couleurs | |
| UV moyens (320 nm) | |
| └─ Fréquence | |
| └─ Intesité | |
| └─ Couleurs | |
| └─ Autres couleurs | |
| UV courts (254 nm) | |
| └─ Fréquence | |
| └─ Intesité | |
| └─ Couleurs | |
| └─ Autres couleurs | |
| Fluorescence UV | |
| └─ Activateur principal | |
| └─ Autres activateurs |
| Handbook of mineralogy | https://handbookofmineralogy.org/pdfs/tatarskite.pdf |
| Mindat | http://www.mindat.org/show.php?name=tatarskite |
| Mineralienatlas | https://www.mineralienatlas.de/lexikon/index.php/MineralData?mineral=tatarskite |
| RRUFF | https://rruff.net/tatarskite |
| Rruff IMA | https://www.rruff.net/ima-mineral-list/?tatarskite |
| Smorf Crystal Model | https://www.smorf.nl/crystals_az_naam.php?naam=t |
| Strahlen | https://www.strahlen.org/tw/fotoatlas1/tatarskite_foto.html |
| Webmineral | https://webmineral.com/data/Tatarskite.shtml |
| 1001 Minéraux | https://1001mineraux.com/collections/tatarskite |
| Anton Waltz Minerals | https://www.awminerals.com/ |
| e-rocks | https://e-rocks.com/itemssearch?search=tatarskite&op=Submit&form_id=klondike_search_quick_form |
| FossilEra | https://www.fossilera.com/minerals-for-sale/tatarskite |
| Gem Select | https://www.gemselect.com/tatarskite/tatarskite.php |
| Gemfrance | https://www.gemfrance.com/catalogsearch/result/?q=tatarskite |
| Le Comptoir Géologique (Gemmes) | https://www.le-comptoir-geologique.com/tatarskite-gemme.html |
| Le Comptoir Géologique (Minéraux) | https://www.le-comptoir-geologique.com/tatarskite-mineraux.html |
| Pegmatite | http://pegmatite.ru |
| Shungite.fr (La Roche Mère) | https://shungite.fr/fr/recherche?controller=search&s=tatarskite |
| The Arkenstone | https://www.irocks.com/search?mode=advanced&query=tatarskite&status%5B%5D=available&status%5B%5D=on-hold&status%5B%5D=sold |
| Weinrich Minerals | https://www.weinrichmineralsinc.com/product/shop/archive?name=tatarskite |