| Nom | Philolithite |
| └─ Allemand (de) | Philolithit |
| └─ Anglais (en) | Philolithite |
| └─ Espagnol (es) | Philolithita |
| └─ Français (fr) | Philolithite |
| └─ IMA (im) | IMA1996-020 |
| └─ Russe (ru) | Филолитит |
| Origine | The name is from the Greek philos (=loving) and lithos (=stone) in honor of the Friends of Mineralogy. |
| Statut | A ▶ Approuvé |
| Nom | Philolithite |
| Code | 1996-020 |
| Symbole | Phi |
| Formule | Pb12O6Mn7(SO4)(CO3)4Cl4(OH)12 |
| Pays | SWE |
| Météorite | Non |
| Référence 1 | Mineralogical Record 29 (1998), 201 |
| Référence 2 | American Mineralogist 85 (2000), 810 |
| Archive | 2025-11 |
| Webmineral | Pb12O6Mn(Mg,Mn)2(Mn,Mg)4(SO4)(CO3)4Cl4(OH)12 |
| Mineralienatlas | Pb12O6Mn7(SO4)(CO3)4Cl4(OH)12 |
| Mineralienatlas (Empirique) | Pb12O6Mn7(SO4)(CO3)4Cl4(OH)12 |
| Rruff | Pb2+12O6Mn2+7(S6+O4)(CO3)4Cl4(OH)12 |
| Formule de référence | Pb12O6Mn7(SO4)(CO3)4Cl4(OH)12 |
| Masse atomique (u ≡ Da) | 3649.0775 |
| Masse molaire #1 (g.mol-1) | 3649.0775 |
| Element | Quantité | % Atomes | Masse (u ≡ Da) | Total masse (u ≡ Da) | % Masse |
|---|---|---|---|---|---|
| H | 12.00 | 16.22 | 1.00797500 | 12.09570000 | 0.33 |
| C | 4.00 | 5.41 | 12.01060000 | 48.04240000 | 1.32 |
| O | 34.00 | 45.95 | 15.99940000 | 543.97960000 | 14.91 |
| S | 1.00 | 1.35 | 32.06750000 | 32.06750000 | 0.88 |
| Cl | 4.00 | 5.41 | 35.45150000 | 141.80600000 | 3.89 |
| Mn | 7.00 | 9.46 | 54.93804400 | 384.56630800 | 10.54 |
| Pb | 12.00 | 16.22 | 207.21000000 | 2486.52000000 | 68.14 |
| Total | 74.00 | 100.00 | 3649.07750800 | 100.00 |
| Dureté de Mohs | 3 - 4 |
| Dureté de Vickers | |
| Densité électronique #1 (g/cm3) | 5.02 |
| Indice de fermions | 0,15 |
| Indice de bosons | 0,85 |
| Photoélectricité | |
| └─ PEPhilolithite (barns/électron) | 1 254,07 |
| └─ U #2 (barns/cm3) | 6 295,4314 |
| GRapi #3 | 0 |
| Strunz 9ed. | 05 ▶ Carbonates et nitrates └─ 05.B ▶ Carbonates avec anions additionnels, sans H2O └─ 05.BF ▶ Avec (Cl), SO4, PO4, TeO3 └─ 05.BF.35 ▶ Philolithite |
| Dana 8ed. | 32 ▶ Compound Sulfates └─ 32.03 ▶ Compound Sulfates (Anhydres) avec poly-anionic formula └─ 32.03.04 ▶ (Indéfini) └─ 32.03.04.02 ▶ Philolithite |
| CIM Hey's | |
| Lapis | III ▶ Halogénures (fluorures, chlorures, bromures, iodures) └─ III/D ▶ Oxyhalogénures └─ III/D.10 ▶ Oxyhalogénures avec Pb–Bi–Sb et composés apparentés └─ III/D.10-120 ▶ Philolithite |
| Hölzel | 5 ▶ Carbonates, nitrates, arsénites, sulfites, sélénites, tellurites, iodates └─ 5.B ▶ Carbonates avec autres anions, sans H2O └─ 5.BC.3 ▶ (Indéfini) └─ 5.BC.320 ▶ Philolithite |
| Système cristallin | |
| └─ Notation Hermann–Mauguin | |
| └─ Règles longueurs | |
| └─ Règles angles | |
| Classe cristalline | |
| └─ Notation Hermann–Mauguin | |
| └─ Notation Schoenflies | |
| └─ Axes binaires (180°) | 0 |
| └─ Axes ternaires (120°) | 0 |
| └─ Axes quaternaires (90°) | 0 |
| └─ Axes senaires (60°) | 0 |
| └─ Plans de symétrie | 0 |
| └─ Inversion centrale | Oui |
| Groupe d'espace | |
| └─ Notation Hermann–Mauguin | |
| Groupe de plan | |
| └─ Notation Hermann–Mauguin | |
| Mailles | |
| └─ a (Å) | 12.627 |
| └─ b (Å) | 12.627 |
| └─ c (Å) | 12.595 |
| Rapport | |
| └─ Rapport a/b | 1.000 |
| └─ Rapport c/a | 0.997 |
| └─ Rapport c/b | 0.997 |
| Angles | |
| └─ α (°) | 90 |
| └─ β (°) | 90 |
| └─ γ (°) | 90 |
| Z #1 | 2 |
| Volume (calculé) #2 (Å3) | 2008.161 |
| Densité (calculé) ρ #3 (g/cm3) | 6.035 |
| Système cristallin | |
| └─ Angle 2V | (+) |
| └─ Angle (°) | 60° |
| └─ Anisotropie | Non |
| └─ Biréfringence Maxi. | |
| └─ Absorption | Aucune |
| └─ Pléochroïsme | Aucun |
| └─ Pléochroïsme X | Aucun |
| └─ Pléochroïsme Y | Aucun |
| └─ Pléochroïsme Z | Aucun |
| └─ Indice moyen | 1,95 |
| └─ Indice α / ω / n | 1,95 |
| └─ Indice β | |
| └─ Indice γ / ε | |
| Validation Gladstone-Dale | |
| └─ KC #1 | 0.1603 |
| └─ KPD calculé | 0.158 |
| └─ CI #2 calculé | 0,014 ▶ Excellent |
| └─ KPD mesuré | 0.1585 |
| └─ CI #2 mesuré | 0,011 ▶ Excellent |
| └─ N calculé | |
| Opacité |
| UV longs (365 nm) | |
| └─ Fréquence | |
| └─ Intesité | |
| └─ Couleurs | |
| └─ Autres couleurs | |
| UV moyens (320 nm) | |
| └─ Fréquence | |
| └─ Intesité | |
| └─ Couleurs | |
| └─ Autres couleurs | |
| UV courts (254 nm) | |
| └─ Fréquence | |
| └─ Intesité | |
| └─ Couleurs | |
| └─ Autres couleurs | |
| Fluorescence UV | |
| └─ Activateur principal | |
| └─ Autres activateurs |
| Handbook of mineralogy | https://handbookofmineralogy.org/pdfs/philolithite.pdf |
| Mindat | http://www.mindat.org/show.php?name=philolithite |
| Mineralienatlas | https://www.mineralienatlas.de/lexikon/index.php/MineralData?mineral=philolithite |
| RRUFF | https://rruff.net/philolithite |
| Rruff IMA | https://www.rruff.net/ima-mineral-list/?philolithite |
| Smorf Crystal Model | https://www.smorf.nl/crystals_az_naam.php?naam=p |
| Strahlen | https://www.strahlen.org/tw/fotoatlas1/philolithite_foto.html |
| Webmineral | https://webmineral.com/data/Philolithite.shtml |
| 1001 Minéraux | https://1001mineraux.com/collections/philolithite |
| Anton Waltz Minerals | https://www.awminerals.com/ |
| e-rocks | https://e-rocks.com/itemssearch?search=philolithite&op=Submit&form_id=klondike_search_quick_form |
| FossilEra | https://www.fossilera.com/minerals-for-sale/philolithite |
| Gem Select | https://www.gemselect.com/philolithite/philolithite.php |
| Gemfrance | https://www.gemfrance.com/catalogsearch/result/?q=philolithite |
| Le Comptoir Géologique (Gemmes) | https://www.le-comptoir-geologique.com/philolithite-gemme.html |
| Le Comptoir Géologique (Minéraux) | https://www.le-comptoir-geologique.com/philolithite-mineraux.html |
| Pegmatite | http://pegmatite.ru |
| Shungite.fr (La Roche Mère) | https://shungite.fr/fr/recherche?controller=search&s=philolithite |
| The Arkenstone | https://www.irocks.com/search?mode=advanced&query=philolithite&status%5B%5D=available&status%5B%5D=on-hold&status%5B%5D=sold |
| Weinrich Minerals | https://www.weinrichmineralsinc.com/product/shop/archive?name=philolithite |