| Nom | Arsenogoyazite |
| └─ Allemand (de) | Arsenogoyazit |
| └─ Anglais (en) | Arsenogoyazite |
| └─ Espagnol (es) | Arsenogoyazita |
| └─ Français (fr) | Arsenogoyazite |
| └─ IMA (im) | IMA1983-043 |
| └─ Italien (it) | Weilerita |
| └─ Russe (ru) | Арсеногойяцит |
| └─ Russe (ru) | Арсеногояцит |
| Origine | Named for the chemical composition and it's relationship to goyazite. |
| Statut | A ▶ Approuvé |
| Nom | Arsenogoyazite |
| Code | 1983-043 |
| Symbole | Agoy |
| Formule | SrAl3(AsO4)(AsO3OH)(OH)6 |
| Pays | DEU |
| Météorite | Non |
| Référence 1 | Schweizerische Mineralogische und Petrographische Mitteilungen 64 (1984), 11 |
| Référence 2 | Mineralogical Magazine 74 (2010), 919 |
| Archive | 2025-11 |
| Webmineral | (Sr,Ca,Ba)Al3(AsO4,PO4)2(OH,F)5 |
| Mineralienatlas | name="Zusatzinformationen"> |
| Mineralienatlas (Empirique) | (Sr0.6Ca0.3Ba0.1)Al3(AsO4)(AsO3OH)(OH)6 |
| Rruff | SrAl3(As5+O4)(As5+O3OH)(OH)6 |
| Formule de référence | (Sr0.6Ca0.3Ba0.1)Al3(AsO4)(AsO3OH)(OH)6 |
| Masse atomique (u ≡ Da) | 540.1641 |
| Masse molaire #1 (g.mol-1) | 540.1641 |
| Element | Quantité | % Atomes | Masse (u ≡ Da) | Total masse (u ≡ Da) | % Masse |
|---|---|---|---|---|---|
| H | 7.00 | 25.93 | 1.00797500 | 7.05582500 | 1.31 |
| O | 14.00 | 51.85 | 15.99940000 | 223.99160000 | 41.47 |
| Al | 3.00 | 11.11 | 26.98153850 | 80.94461550 | 14.99 |
| Ca | 0.30 | 1.11 | 40.07840000 | 12.02352048 | 2.23 |
| As | 2.00 | 7.41 | 74.92159500 | 149.84319000 | 27.74 |
| Sr | 0.60 | 2.22 | 87.62100000 | 52.57260209 | 9.73 |
| Ba | 0.10 | 0.37 | 137.32770000 | 13.73277020 | 2.54 |
| Total | 27.00 | 100.00 | 540.16412327 | 100.00 |
| Dureté de Mohs | 4 |
| Dureté de Vickers | |
| Densité électronique #1 (g/cm3) | 3.21 |
| Indice de fermions | 0,01 |
| Indice de bosons | 0,99 |
| Photoélectricité | |
| └─ PEArsenogoyazite (barns/électron) | 36,36 |
| └─ U #2 (barns/cm3) | 116,7156 |
| GRapi #3 | 0 |
| Strunz 9ed. | 08 ▶ Phosphates, arséniates, vanadates └─ 08.B ▶ Phosphates, etc. avec anions additionnels, sans H2O └─ 08.BL ▶ Avec medium-sized and large cations, (OH, etc) : RO4 = 3:1 └─ 08.BL.10 ▶ Arsenogoyazite |
| Dana 8ed. | 42 ▶ Phosphates hydratés , etc, contenant Hydroxyle ou Halogène └─ 42.07 ▶ Phosphates hydratés , etc, contenant Hydroxyle ou Halogène où (AB)5 (XO4)3 Zq · x(H2O) └─ 42.07.04 ▶ arsenocrandallite group └─ 42.07.04.03 ▶ Arsenogoyazite |
| CIM Hey's | |
| Lapis | VII ▶ Phosphates et arsénates (« phosphates » incluent toujours les arsénates et les vanadates isotypes) └─ VII/B ▶ Phosphates anhydres, avec anions étrangers F, Cl, O, OH └─ VII/B.36 ▶ Cations moyens et gros : Mg–Cu–Zn et Ca–Na–K–Ba–Pb ; groupe du crandallite └─ VII/B.36-040 ▶ Arsenogoyazite |
| Hölzel | 8 ▶ Phosphates, arsénates, vanadates └─ 8.B ▶ Phosphates, etc., avec autres anions, sans H2O └─ 8.BK.1 ▶ Avec Ca, Sr, Ba — Groupe Goyazite–Crandallite └─ 8.BK.150 ▶ Arsenogoyazite |
| Système cristallin | Trigonal ≡ Rhombohedral |
| └─ Notation Hermann–Mauguin | 3m |
| └─ Règles longueurs | a = b ≠ c |
| └─ Règles angles | α = β = 90°, γ = 120° |
| Classe cristalline | Trigonal rhomboédral hexagonal |
| └─ Notation Hermann–Mauguin | 3m |
| └─ Notation Schoenflies | D3d |
| └─ Axes binaires (180°) | 3 |
| └─ Axes ternaires (120°) | 1 |
| └─ Axes quaternaires (90°) | 0 |
| └─ Axes senaires (60°) | 0 |
| └─ Plans de symétrie | 3 |
| └─ Inversion centrale | Oui |
| Groupe d'espace | 166 |
| └─ Notation Hermann–Mauguin | R3m |
| Groupe de plan | |
| └─ Notation Hermann–Mauguin | |
| Mailles | |
| └─ a (Å) | 7.10 |
| └─ b (Å) | (Indéfini) |
| └─ c (Å) | 17.16 |
| Rapport | |
| └─ Rapport a/b | |
| └─ Rapport c/a | 2.417 |
| └─ Rapport c/b | |
| Angles | |
| └─ α (°) | 90 |
| └─ β (°) | 90 |
| └─ γ (°) | 120 |
| Z #1 | 3 |
| Volume (calculé) #2 (Å3) | |
| Densité (calculé) ρ #3 (g/cm3) |
| Système cristallin | Trigonal ≡ Rhombohedral |
| └─ Angle 2V | Uniaxe |
| └─ Anisotropie | Oui |
| └─ Biréfringence Maxi. | |
| └─ Absorption (E/O) | |
| └─ Pléochroïsme | |
| └─ Pléochroïsme X | |
| └─ Pléochroïsme Y | |
| └─ Pléochroïsme Z | |
| └─ Indice moyen | 1,64 |
| └─ Indice α / ω / n | 1,64 |
| └─ Indice β | |
| └─ Indice γ / ε | |
| Validation Gladstone-Dale | |
| └─ KC #1 | 0.1931 |
| └─ KPD calculé | 0.1882 |
| └─ CI #2 calculé | 0,025 ▶ Bon |
| └─ KPD mesuré | 0.1916 |
| └─ CI #2 mesuré | 0,008 ▶ Excellent |
| └─ N calculé | 1.64 - 1.66 |
| Opacité |
| UV longs (365 nm) | |
| └─ Fréquence | |
| └─ Intesité | |
| └─ Couleurs | |
| └─ Autres couleurs | |
| UV moyens (320 nm) | |
| └─ Fréquence | |
| └─ Intesité | |
| └─ Couleurs | |
| └─ Autres couleurs | |
| UV courts (254 nm) | |
| └─ Fréquence | |
| └─ Intesité | |
| └─ Couleurs | |
| └─ Autres couleurs | |
| Fluorescence UV | |
| └─ Activateur principal | |
| └─ Autres activateurs |
| Handbook of mineralogy | https://handbookofmineralogy.org/pdfs/arsenogoyazite.pdf |
| Mindat | http://www.mindat.org/show.php?name=arsenogoyazite |
| Mineralienatlas | https://www.mineralienatlas.de/lexikon/index.php/MineralData?mineral=arsenogoyazite |
| RRUFF | https://rruff.net/arsenogoyazite |
| Rruff IMA | https://www.rruff.net/ima-mineral-list/?arsenogoyazite |
| Smorf Crystal Model | https://www.smorf.nl/crystals_az_naam.php?naam=a |
| Strahlen | https://www.strahlen.org/tw/fotoatlas1/arsenogoyazite_foto.html |
| Webmineral | https://webmineral.com/data/Arsenogoyazite.shtml |
| 1001 Minéraux | https://1001mineraux.com/collections/arsenogoyazite |
| Anton Waltz Minerals | https://www.awminerals.com/ |
| e-rocks | https://e-rocks.com/itemssearch?search=arsenogoyazite&op=Submit&form_id=klondike_search_quick_form |
| FossilEra | https://www.fossilera.com/minerals-for-sale/arsenogoyazite |
| Gem Select | https://www.gemselect.com/arsenogoyazite/arsenogoyazite.php |
| Gemfrance | https://www.gemfrance.com/catalogsearch/result/?q=arsenogoyazite |
| Le Comptoir Géologique (Gemmes) | https://www.le-comptoir-geologique.com/arsenogoyazite-gemme.html |
| Le Comptoir Géologique (Minéraux) | https://www.le-comptoir-geologique.com/arsenogoyazite-mineraux.html |
| Pegmatite | http://pegmatite.ru |
| Shungite.fr (La Roche Mère) | https://shungite.fr/fr/recherche?controller=search&s=arsenogoyazite |
| The Arkenstone | https://www.irocks.com/search?mode=advanced&query=arsenogoyazite&status%5B%5D=available&status%5B%5D=on-hold&status%5B%5D=sold |
| Weinrich Minerals | https://www.weinrichmineralsinc.com/product/shop/archive?name=arsenogoyazite |